C35H50O4P2 — CID 59422614
(2,4-ditert-butylphenoxy)-[2-[(2,4-ditert-butylphenoxy)phosphanyloxymethyl]phenoxy]phosphane (PubChem CID 59422614) has the molecular formula C35H50O4P2 and a molecular weight of 596.73 g/mol. Its IUPAC name is (2,4-ditert-butylphenoxy)-[2-[(2,4-ditert-butylphenoxy)phosphanyloxymethyl]phenoxy]phosphane.
| Compound Name | (2,4-ditert-butylphenoxy)-[2-[(2,4-ditert-butylphenoxy)phosphanyloxymethyl]phenoxy]phosphane |
|---|---|
| PubChem CID | 59422614 |
| Molecular Formula | C35H50O4P2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.32 |
| IUPAC Name | (2,4-ditert-butylphenoxy)-[2-[(2,4-ditert-butylphenoxy)phosphanyloxymethyl]phenoxy]phosphane |
| SMILES | CC(C)(C)c1ccc(OPOCc2ccccc2OPOc2ccc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H50O4P2/c1-32(2,3)25-17-19-30(27(21-25)34(7,8)9)38-40-36-23-24-15-13-14-16-29(24)37-41-39-31-20-18-26(33(4,5)6)22-28(31)35(10,11)12/h13-22,40-41H,23H2,1-12H3 |
| InChIKey | UUZAOCWBEXQLSB-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|