C23H30O3 — CID 22685837
2-[2-(2,4-ditert-butylphenoxy)ethoxy]benzaldehyde (PubChem CID 22685837) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is 2-[2-(2,4-ditert-butylphenoxy)ethoxy]benzaldehyde.
| Compound Name | 2-[2-(2,4-ditert-butylphenoxy)ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 22685837 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 2-[2-(2,4-ditert-butylphenoxy)ethoxy]benzaldehyde |
| SMILES | CC(C)(C)c1ccc(OCCOc2ccccc2C=O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H30O3/c1-22(2,3)18-11-12-21(19(15-18)23(4,5)6)26-14-13-25-20-10-8-7-9-17(20)16-24/h7-12,15-16H,13-14H2,1-6H3 |
| InChIKey | ZWDBMCZECGOSQI-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|