C42H61Cl2P — CID 101225089
[2,6-bis(2,4,6-tritert-butylphenyl)phenyl]-dichlorophosphane (PubChem CID 101225089) has the molecular formula C42H61Cl2P and a molecular weight of 667.83 g/mol. Its IUPAC name is [2,6-bis(2,4,6-tritert-butylphenyl)phenyl]-dichlorophosphane.
| Compound Name | [2,6-bis(2,4,6-tritert-butylphenyl)phenyl]-dichlorophosphane |
|---|---|
| PubChem CID | 101225089 |
| Molecular Formula | C42H61Cl2P |
| Molecular Weight | 667.83 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | [2,6-bis(2,4,6-tritert-butylphenyl)phenyl]-dichlorophosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(-c2cccc(-c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)c2P(Cl)Cl)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H61Cl2P/c1-37(2,3)26-22-30(39(7,8)9)34(31(23-26)40(10,11)12)28-20-19-21-29(36(28)45(43)44)35-32(41(13,14)15)24-27(38(4,5)6)25-33(35)42(16,17)18/h19-25H,1-18H3 |
| InChIKey | BBNHSGMPZZTLNF-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.83 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|