C20H32ClP — CID 14494179
chloro-ethenyl-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 14494179) has the molecular formula C20H32ClP and a molecular weight of 338.90 g/mol. Its IUPAC name is chloro-ethenyl-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | chloro-ethenyl-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 14494179 |
| Molecular Formula | C20H32ClP |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | chloro-ethenyl-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | C=CP(Cl)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H32ClP/c1-11-22(21)17-15(19(5,6)7)12-14(18(2,3)4)13-16(17)20(8,9)10/h11-13H,1H2,2-10H3 |
| InChIKey | GFHABEMMOQXHJB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|