C19H29NS — CID 13308804
1,3,5-tritert-butyl-2-isothiocyanatobenzene (PubChem CID 13308804) has the molecular formula C19H29NS and a molecular weight of 303.52 g/mol. Its IUPAC name is 1,3,5-tritert-butyl-2-isothiocyanatobenzene.
| Compound Name | 1,3,5-tritert-butyl-2-isothiocyanatobenzene |
|---|---|
| PubChem CID | 13308804 |
| Molecular Formula | C19H29NS |
| Molecular Weight | 303.52 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 1,3,5-tritert-butyl-2-isothiocyanatobenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(N=C=S)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H29NS/c1-17(2,3)13-10-14(18(4,5)6)16(20-12-21)15(11-13)19(7,8)9/h10-11H,1-9H3 |
| InChIKey | WRACHIRWVILYMO-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|