C18H29FNP — CID 14492991
fluoro-(2,4,6-tritert-butylphenyl)iminophosphane (PubChem CID 14492991) has the molecular formula C18H29FNP and a molecular weight of 309.41 g/mol. Its IUPAC name is fluoro-(2,4,6-tritert-butylphenyl)iminophosphane.
| Compound Name | fluoro-(2,4,6-tritert-butylphenyl)iminophosphane |
|---|---|
| PubChem CID | 14492991 |
| Molecular Formula | C18H29FNP |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.20 |
| IUPAC Name | fluoro-(2,4,6-tritert-butylphenyl)iminophosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/N=P/F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H29FNP/c1-16(2,3)12-10-13(17(4,5)6)15(20-21-19)14(11-12)18(7,8)9/h10-11H,1-9H3 |
| InChIKey | YXAZCLSIPIAEDD-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|