About bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane
bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 11003156) has the molecular formula C19H30BrP
and a molecular weight of 369.33 g/mol. Its IUPAC name is bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane.
Molecular Properties
| Compound Name | bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane |
| PubChem CID | 11003156 |
| Molecular Formula | C19H30BrP |
| Molecular Weight | 369.33 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C\Br)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H30BrP/c1-17(2,3)13-10-14(18(4,5)6)16(21-12-20)15(11-13)19(7,8)9/h10-12H,1-9H3 |
| InChIKey | AYMQDBYIQWXMRT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.33 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane?
The IUPAC name of bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane (CID 11003156) is bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane.
What is the SMILES notation for bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane?
The canonical SMILES for bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane is CC(C)(C)c1cc(C(C)(C)C)c(/P=C\Br)c(C(C)(C)C)c1.
What is the InChIKey of bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane?
The InChIKey is AYMQDBYIQWXMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30BrP/c1-17(2,3)13-10-14(18(4,5)6)16(21-12-20)15(11-13)19(7,8)9/h10-12H,1-9H3.
What are the key properties of bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane?
bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane has a molecular weight of 369.33 g/mol, XLogP of 6.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethylidene-(2,4,6-tritert-butylphenyl)phosphane is sourced from PubChem (CID 11003156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).