C22H39PSi — CID 12776595
(2,4,6-tritert-butylphenyl)-(trimethylsilylmethylidene)phosphane (PubChem CID 12776595) has the molecular formula C22H39PSi and a molecular weight of 362.61 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl)-(trimethylsilylmethylidene)phosphane.
| Compound Name | (2,4,6-tritert-butylphenyl)-(trimethylsilylmethylidene)phosphane |
|---|---|
| PubChem CID | 12776595 |
| Molecular Formula | C22H39PSi |
| Molecular Weight | 362.61 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | (2,4,6-tritert-butylphenyl)-(trimethylsilylmethylidene)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C/[Si](C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H39PSi/c1-20(2,3)16-13-17(21(4,5)6)19(23-15-24(10,11)12)18(14-16)22(7,8)9/h13-15H,1-12H3 |
| InChIKey | OYHAQPLZRWJFTL-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|