C25H34ClP — CID 101336362
(4-chlorophenyl)methylidene-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 101336362) has the molecular formula C25H34ClP and a molecular weight of 400.97 g/mol. Its IUPAC name is (4-chlorophenyl)methylidene-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | (4-chlorophenyl)methylidene-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 101336362 |
| Molecular Formula | C25H34ClP |
| Molecular Weight | 400.97 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | (4-chlorophenyl)methylidene-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C/c2ccc(Cl)cc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H34ClP/c1-23(2,3)18-14-20(24(4,5)6)22(21(15-18)25(7,8)9)27-16-17-10-12-19(26)13-11-17/h10-16H,1-9H3 |
| InChIKey | DMQKNZTVPTXKCB-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.97 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|