C54H72O2P2 — CID 11389161
[2,3-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 11389161) has the molecular formula C54H72O2P2 and a molecular weight of 815.12 g/mol. Its IUPAC name is [2,3-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | [2,3-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 11389161 |
| Molecular Formula | C54H72O2P2 |
| Molecular Weight | 815.12 g/mol |
| Exact Mass | 814.50 |
| IUPAC Name | [2,3-bis(4-methoxyphenyl)-4-(2,4,6-tritert-butylphenyl)phosphanylidenecyclobut-2-en-1-ylidene]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | COc1ccc(-c2c(-c3ccc(OC)cc3)c(=P\c3c(C(C)(C)C)cc(C(C)(C)C)cc3C(C)(C)C)/c2=P\c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C54H72O2P2/c1-49(2,3)35-29-39(51(7,8)9)45(40(30-35)52(10,11)12)57-47-43(33-21-25-37(55-19)26-22-33)44(34-23-27-38(56-20)28-24-34)48(47)58-46-41(53(13,14)15)31-36(50(4,5)6)32-42(46)54(16,17)18/h21-32H,1-20H3 |
| InChIKey | VKFACBNRZQZMDQ-UHFFFAOYSA-N |
| XLogP | 15.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.12 |
| LogP ≤ 5 | 15.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|