C48H74O2P2 — CID 102531963
butyl-[(4-methoxyphenyl)-(2,4,6-tritert-butylphenyl)phosphanylidenemethoxy]-(2,4,6-tritert-butylphenyl)phosphane (PubChem CID 102531963) has the molecular formula C48H74O2P2 and a molecular weight of 745.07 g/mol. Its IUPAC name is butyl-[(4-methoxyphenyl)-(2,4,6-tritert-butylphenyl)phosphanylidenemethoxy]-(2,4,6-tritert-butylphenyl)phosphane.
| Compound Name | butyl-[(4-methoxyphenyl)-(2,4,6-tritert-butylphenyl)phosphanylidenemethoxy]-(2,4,6-tritert-butylphenyl)phosphane |
|---|---|
| PubChem CID | 102531963 |
| Molecular Formula | C48H74O2P2 |
| Molecular Weight | 745.07 g/mol |
| Exact Mass | 744.52 |
| IUPAC Name | butyl-[(4-methoxyphenyl)-(2,4,6-tritert-butylphenyl)phosphanylidenemethoxy]-(2,4,6-tritert-butylphenyl)phosphane |
| SMILES | CCCCP(O/C(=P/c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)c1ccc(OC)cc1)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C48H74O2P2/c1-21-22-27-52(41-38(47(14,15)16)30-34(44(5,6)7)31-39(41)48(17,18)19)50-42(32-23-25-35(49-20)26-24-32)51-40-36(45(8,9)10)28-33(43(2,3)4)29-37(40)46(11,12)13/h23-26,28-31H,21-22,27H2,1-20H3 |
| InChIKey | MMHNAKCMOUGHIE-UHFFFAOYSA-N |
| XLogP | 13.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.07 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|