C27H47PSi — CID 15773778
butyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane (PubChem CID 15773778) has the molecular formula C27H47PSi and a molecular weight of 430.73 g/mol. Its IUPAC name is butyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane.
| Compound Name | butyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane |
|---|---|
| PubChem CID | 15773778 |
| Molecular Formula | C27H47PSi |
| Molecular Weight | 430.73 g/mol |
| Exact Mass | 430.32 |
| IUPAC Name | butyl-(2,4,6-tritert-butylphenyl)-(2-trimethylsilylethynyl)phosphane |
| SMILES | CCCCP(C#C[Si](C)(C)C)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C27H47PSi/c1-14-15-16-28(17-18-29(11,12)13)24-22(26(5,6)7)19-21(25(2,3)4)20-23(24)27(8,9)10/h19-20H,14-16H2,1-13H3 |
| InChIKey | BFEMCCZKXLXJBV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.73 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|