C23H36OSi — CID 102078481
2-(2-but-3-enoxy-3,5-ditert-butylphenyl)ethynyl-trimethylsilane (PubChem CID 102078481) has the molecular formula C23H36OSi and a molecular weight of 356.63 g/mol. Its IUPAC name is 2-(2-but-3-enoxy-3,5-ditert-butylphenyl)ethynyl-trimethylsilane.
| Compound Name | 2-(2-but-3-enoxy-3,5-ditert-butylphenyl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 102078481 |
| Molecular Formula | C23H36OSi |
| Molecular Weight | 356.63 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 2-(2-but-3-enoxy-3,5-ditert-butylphenyl)ethynyl-trimethylsilane |
| SMILES | C=CCCOc1c(C#C[Si](C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C23H36OSi/c1-11-12-14-24-21-18(13-15-25(8,9)10)16-19(22(2,3)4)17-20(21)23(5,6)7/h11,16-17H,1,12,14H2,2-10H3 |
| InChIKey | BLPIOAJGKWRFGX-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|