C28H40Si2 — CID 169050031
2-[3,6-ditert-butyl-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane (PubChem CID 169050031) has the molecular formula C28H40Si2 and a molecular weight of 432.80 g/mol. Its IUPAC name is 2-[3,6-ditert-butyl-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[3,6-ditert-butyl-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 169050031 |
| Molecular Formula | C28H40Si2 |
| Molecular Weight | 432.80 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 2-[3,6-ditert-butyl-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)c1cc2cc(C(C)(C)C)c(C#C[Si](C)(C)C)cc2cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C28H40Si2/c1-27(2,3)25-19-24-20-26(28(4,5)6)22(14-16-30(10,11)12)18-23(24)17-21(25)13-15-29(7,8)9/h17-20H,1-12H3 |
| InChIKey | MWBIQMHNGHNVIP-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.80 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|