C35H34Br2S2Si2 — CID 158624840
[1]benzothiolo[5,6-f][1]benzothiole;2-[3,6-dibromo-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane;methane (PubChem CID 158624840) has the molecular formula C35H34Br2S2Si2 and a molecular weight of 734.77 g/mol. Its IUPAC name is [1]benzothiolo[5,6-f][1]benzothiole;2-[3,6-dibromo-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane;methane.
| Compound Name | [1]benzothiolo[5,6-f][1]benzothiole;2-[3,6-dibromo-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane;methane |
|---|---|
| PubChem CID | 158624840 |
| Molecular Formula | C35H34Br2S2Si2 |
| Molecular Weight | 734.77 g/mol |
| Exact Mass | 732.00 |
| IUPAC Name | [1]benzothiolo[5,6-f][1]benzothiole;2-[3,6-dibromo-7-(2-trimethylsilylethynyl)naphthalen-2-yl]ethynyl-trimethylsilane;methane |
| SMILES | C.C[Si](C)(C)C#Cc1cc2cc(C#C[Si](C)(C)C)c(Br)cc2cc1Br.c1cc2cc3cc4ccsc4cc3cc2s1 |
| InChI | InChI=1S/C20H22Br2Si2.C14H8S2.CH4/c1-23(2,3)9-7-15-11-17-12-16(8-10-24(4,5)6)20(22)14-18(17)13-19(15)21;1-3-15-13-7-12-8-14-10(2-4-16-14)6-11(12)5-9(1)13;/h11-14H,1-6H3;1-8H;1H4 |
| InChIKey | HYLORVLCMCBSRG-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.77 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|