C33H32S2Si — CID 58410993
2-(7,19-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),5,9,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl-tri(propan-2-yl)silane (PubChem CID 58410993) has the molecular formula C33H32S2Si and a molecular weight of 520.84 g/mol. Its IUPAC name is 2-(7,19-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),5,9,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-(7,19-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),5,9,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 58410993 |
| Molecular Formula | C33H32S2Si |
| Molecular Weight | 520.84 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-(7,19-dithiahexacyclo[11.11.0.02,10.04,8.014,22.016,20]tetracosa-1(13),2,4(8),5,9,11,14(22),15,17,20,23-undecaen-6-yl)ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1cc2cc3c(ccc4c5cc6ccsc6cc5ccc34)cc2s1)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H32S2Si/c1-20(2)36(21(3)4,22(5)6)14-12-27-15-26-17-31-24(19-33(26)35-27)8-10-28-29(31)9-7-23-18-32-25(11-13-34-32)16-30(23)28/h7-11,13,15-22H,1-6H3 |
| InChIKey | HWMCNQGGIMVOSS-UHFFFAOYSA-N |
| XLogP | 11.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.84 |
| LogP ≤ 5 | 11.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|