C32H36S2Si — CID 122390718
tri(butan-2-yl)-[2-(6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,16,19-nonaen-2-yl)ethynyl]silane (PubChem CID 122390718) has the molecular formula C32H36S2Si and a molecular weight of 512.86 g/mol. Its IUPAC name is tri(butan-2-yl)-[2-(6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,16,19-nonaen-2-yl)ethynyl]silane.
| Compound Name | tri(butan-2-yl)-[2-(6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,16,19-nonaen-2-yl)ethynyl]silane |
|---|---|
| PubChem CID | 122390718 |
| Molecular Formula | C32H36S2Si |
| Molecular Weight | 512.86 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | tri(butan-2-yl)-[2-(6,18-dithiapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),2,4,7,9,11,14,16,19-nonaen-2-yl)ethynyl]silane |
| SMILES | CCC(C)[Si](C#Cc1c2cc3sccc3cc2cc2cc3ccsc3cc12)(C(C)CC)C(C)CC |
| InChI | InChI=1S/C32H36S2Si/c1-7-21(4)35(22(5)8-2,23(6)9-3)15-12-28-29-19-31-24(10-13-33-31)16-26(29)18-27-17-25-11-14-34-32(25)20-30(27)28/h10-11,13-14,16-23H,7-9H2,1-6H3 |
| InChIKey | YRHZKWUDFXFAIG-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.86 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|