C10H6OS — CID 121459085
thieno[3,2-f][2]benzofuran (PubChem CID 121459085) has the molecular formula C10H6OS and a molecular weight of 174.22 g/mol. Its IUPAC name is thieno[3,2-f][2]benzofuran.
| Compound Name | thieno[3,2-f][2]benzofuran |
|---|---|
| PubChem CID | 121459085 |
| Molecular Formula | C10H6OS |
| Molecular Weight | 174.22 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | thieno[3,2-f][2]benzofuran |
| SMILES | c1cc2cc3cocc3cc2s1 |
| InChI | InChI=1S/C10H6OS/c1-2-12-10-4-9-6-11-5-8(9)3-7(1)10/h1-6H |
| InChIKey | UTYWROZIKOKFKP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |