C14H9NS2 — CID 129178000
[1]benzothiolo[6,5-f][1]benzothiol-7-amine (PubChem CID 129178000) has the molecular formula C14H9NS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is [1]benzothiolo[6,5-f][1]benzothiol-7-amine.
| Compound Name | [1]benzothiolo[6,5-f][1]benzothiol-7-amine |
|---|---|
| PubChem CID | 129178000 |
| Molecular Formula | C14H9NS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | [1]benzothiolo[6,5-f][1]benzothiol-7-amine |
| SMILES | Nc1cc2cc3cc4sccc4cc3cc2s1 |
| InChI | InChI=1S/C14H9NS2/c15-14-7-11-4-10-5-12-8(1-2-16-12)3-9(10)6-13(11)17-14/h1-7H,15H2 |
| InChIKey | WZBAZUFWKODSIL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |