C10H8N2S — CID 69035471
7H-thieno[3,2-f]indol-2-amine (PubChem CID 69035471) has the molecular formula C10H8N2S and a molecular weight of 188.25 g/mol. Its IUPAC name is 7H-thieno[3,2-f]indol-2-amine.
| Compound Name | 7H-thieno[3,2-f]indol-2-amine |
|---|---|
| PubChem CID | 69035471 |
| Molecular Formula | C10H8N2S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 7H-thieno[3,2-f]indol-2-amine |
| SMILES | Nc1cc2cc3cc[nH]c3cc2s1 |
| InChI | InChI=1S/C10H8N2S/c11-10-4-7-3-6-1-2-12-8(6)5-9(7)13-10/h1-5,12H,11H2 |
| InChIKey | KAAKMRDWOYFREV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |