C9H9ClN2S — CID 130788528
6-(chloromethyl)-1-benzothiophene-2,5-diamine (PubChem CID 130788528) has the molecular formula C9H9ClN2S and a molecular weight of 212.71 g/mol. Its IUPAC name is 6-(chloromethyl)-1-benzothiophene-2,5-diamine.
| Compound Name | 6-(chloromethyl)-1-benzothiophene-2,5-diamine |
|---|---|
| PubChem CID | 130788528 |
| Molecular Formula | C9H9ClN2S |
| Molecular Weight | 212.71 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 6-(chloromethyl)-1-benzothiophene-2,5-diamine |
| SMILES | Nc1cc2cc(N)c(CCl)cc2s1 |
| InChI | InChI=1S/C9H9ClN2S/c10-4-6-2-8-5(1-7(6)11)3-9(12)13-8/h1-3H,4,11-12H2 |
| InChIKey | NUNCFRMDPLBCFD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|