C9H7N3S — CID 130839073
2,5-diamino-1-benzothiophene-6-carbonitrile (PubChem CID 130839073) has the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. Its IUPAC name is 2,5-diamino-1-benzothiophene-6-carbonitrile.
| Compound Name | 2,5-diamino-1-benzothiophene-6-carbonitrile |
|---|---|
| PubChem CID | 130839073 |
| Molecular Formula | C9H7N3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 2,5-diamino-1-benzothiophene-6-carbonitrile |
| SMILES | N#Cc1cc2sc(N)cc2cc1N |
| InChI | InChI=1S/C9H7N3S/c10-4-6-2-8-5(1-7(6)11)3-9(12)13-8/h1-3H,11-12H2 |
| InChIKey | IAHNLOTUBALSPA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|