C10H4N2OS — CID 130816987
2-hydroxy-1-benzothiophene-5,6-dicarbonitrile (PubChem CID 130816987) has the molecular formula C10H4N2OS and a molecular weight of 200.22 g/mol. Its IUPAC name is 2-hydroxy-1-benzothiophene-5,6-dicarbonitrile.
| Compound Name | 2-hydroxy-1-benzothiophene-5,6-dicarbonitrile |
|---|---|
| PubChem CID | 130816987 |
| Molecular Formula | C10H4N2OS |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.00 |
| IUPAC Name | 2-hydroxy-1-benzothiophene-5,6-dicarbonitrile |
| SMILES | N#Cc1cc2cc(O)sc2cc1C#N |
| InChI | InChI=1S/C10H4N2OS/c11-4-7-1-6-3-10(13)14-9(6)2-8(7)5-12/h1-3,13H |
| InChIKey | HBFPNQCKQBAYJT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |