C14H4N4 — CID 66972136
naphthalene-2,3,6,7-tetracarbonitrile (PubChem CID 66972136) has the molecular formula C14H4N4 and a molecular weight of 228.21 g/mol. Its IUPAC name is naphthalene-2,3,6,7-tetracarbonitrile.
| Compound Name | naphthalene-2,3,6,7-tetracarbonitrile |
|---|---|
| PubChem CID | 66972136 |
| Molecular Formula | C14H4N4 |
| Molecular Weight | 228.21 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | naphthalene-2,3,6,7-tetracarbonitrile |
| SMILES | N#Cc1cc2cc(C#N)c(C#N)cc2cc1C#N |
| InChI | InChI=1S/C14H4N4/c15-5-11-1-9-2-13(7-17)14(8-18)4-10(9)3-12(11)6-16/h1-4H |
| InChIKey | LGSJQDNMGXBFCJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |