About 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile
6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile (PubChem CID 162415455) has the molecular formula C20H12N4
and a molecular weight of 308.34 g/mol. Its IUPAC name is 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile |
| PubChem CID | 162415455 |
| Molecular Formula | C20H12N4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile |
| SMILES | N#Cc1cc2cc(-c3ccc[nH]3)c(-c3ccc[nH]3)cc2cc1C#N |
| InChI | InChI=1S/C20H12N4/c21-11-15-7-13-9-17(19-3-1-5-23-19)18(20-4-2-6-24-20)10-14(13)8-16(15)12-22/h1-10,23-24H |
| InChIKey | FFQNVIQUKMSOHS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile?
The IUPAC name of 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile (CID 162415455) is 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile.
What is the SMILES notation for 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile?
The canonical SMILES for 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile is N#Cc1cc2cc(-c3ccc[nH]3)c(-c3ccc[nH]3)cc2cc1C#N.
What is the InChIKey of 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile?
The InChIKey is FFQNVIQUKMSOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H12N4/c21-11-15-7-13-9-17(19-3-1-5-23-19)18(20-4-2-6-24-20)10-14(13)8-16(15)12-22/h1-10,23-24H.
What are the key properties of 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile?
6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile has a molecular weight of 308.34 g/mol, XLogP of 4.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile is sourced from PubChem (CID 162415455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).