C20H12N4 — CID 162415455
6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile (PubChem CID 162415455) has the molecular formula C20H12N4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile.
| Compound Name | 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 162415455 |
| Molecular Formula | C20H12N4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 6,7-bis(1H-pyrrol-2-yl)naphthalene-2,3-dicarbonitrile |
| SMILES | N#Cc1cc2cc(-c3ccc[nH]3)c(-c3ccc[nH]3)cc2cc1C#N |
| InChI | InChI=1S/C20H12N4/c21-11-15-7-13-9-17(19-3-1-5-23-19)18(20-4-2-6-24-20)10-14(13)8-16(15)12-22/h1-10,23-24H |
| InChIKey | FFQNVIQUKMSOHS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |