C16H11N5O2 — CID 5209410
2-amino-6-(4-nitrophenyl)-4-(1H-pyrrol-2-yl)pyridine-3-carbonitrile (PubChem CID 5209410) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-amino-6-(4-nitrophenyl)-4-(1H-pyrrol-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(4-nitrophenyl)-4-(1H-pyrrol-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5209410 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-amino-6-(4-nitrophenyl)-4-(1H-pyrrol-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc[nH]2)cc(-c2ccc([N+](=O)[O-])cc2)nc1N |
| InChI | InChI=1S/C16H11N5O2/c17-9-13-12(14-2-1-7-19-14)8-15(20-16(13)18)10-3-5-11(6-4-10)21(22)23/h1-8,19H,(H2,18,20) |
| InChIKey | UPDHLWRURCINFP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|