C8H5NO2 — CID 90887214
3-(1H-pyrrol-2-yl)cyclobut-3-ene-1,2-dione (PubChem CID 90887214) has the molecular formula C8H5NO2 and a molecular weight of 147.13 g/mol. Its IUPAC name is 3-(1H-pyrrol-2-yl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(1H-pyrrol-2-yl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 90887214 |
| Molecular Formula | C8H5NO2 |
| Molecular Weight | 147.13 g/mol |
| Exact Mass | 147.03 |
| IUPAC Name | 3-(1H-pyrrol-2-yl)cyclobut-3-ene-1,2-dione |
| SMILES | O=c1cc(-c2ccc[nH]2)c1=O |
| InChI | InChI=1S/C8H5NO2/c10-7-4-5(8(7)11)6-2-1-3-9-6/h1-4,9H |
| InChIKey | SSBLMBYPGQUJGC-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.13 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|