C26H14N2O2 — CID 44556911
6,7-dibenzoylnaphthalene-2,3-dicarbonitrile (PubChem CID 44556911) has the molecular formula C26H14N2O2 and a molecular weight of 386.41 g/mol. Its IUPAC name is 6,7-dibenzoylnaphthalene-2,3-dicarbonitrile.
| Compound Name | 6,7-dibenzoylnaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 44556911 |
| Molecular Formula | C26H14N2O2 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | 6,7-dibenzoylnaphthalene-2,3-dicarbonitrile |
| SMILES | N#Cc1cc2cc(C(=O)c3ccccc3)c(C(=O)c3ccccc3)cc2cc1C#N |
| InChI | InChI=1S/C26H14N2O2/c27-15-21-11-19-13-23(25(29)17-7-3-1-4-8-17)24(14-20(19)12-22(21)16-28)26(30)18-9-5-2-6-10-18/h1-14H |
| InChIKey | VZHQOMYRCYUELE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |