C15H10N2O2 — CID 135012024
2,2-dimethylbenzo[f][1,3]benzodioxole-6,7-dicarbonitrile (PubChem CID 135012024) has the molecular formula C15H10N2O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 2,2-dimethylbenzo[f][1,3]benzodioxole-6,7-dicarbonitrile.
| Compound Name | 2,2-dimethylbenzo[f][1,3]benzodioxole-6,7-dicarbonitrile |
|---|---|
| PubChem CID | 135012024 |
| Molecular Formula | C15H10N2O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2,2-dimethylbenzo[f][1,3]benzodioxole-6,7-dicarbonitrile |
| SMILES | CC1(C)Oc2cc3cc(C#N)c(C#N)cc3cc2O1 |
| InChI | InChI=1S/C15H10N2O2/c1-15(2)18-13-5-9-3-11(7-16)12(8-17)4-10(9)6-14(13)19-15/h3-6H,1-2H3 |
| InChIKey | BNGVTWPNJDPMOL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |