C9H2BrF4NO2 — CID 117496554
6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine-7-carbonitrile (PubChem CID 117496554) has the molecular formula C9H2BrF4NO2 and a molecular weight of 312.02 g/mol. Its IUPAC name is 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine-7-carbonitrile.
| Compound Name | 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine-7-carbonitrile |
|---|---|
| PubChem CID | 117496554 |
| Molecular Formula | C9H2BrF4NO2 |
| Molecular Weight | 312.02 g/mol |
| Exact Mass | 310.92 |
| IUPAC Name | 6-bromo-2,2,3,3-tetrafluoro-1,4-benzodioxine-7-carbonitrile |
| SMILES | N#Cc1cc2c(cc1Br)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C9H2BrF4NO2/c10-5-2-7-6(1-4(5)3-15)16-8(11,12)9(13,14)17-7/h1-2H |
| InChIKey | AJWCKLWWAWYKOQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.02 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|