C8H4BrNO2 — CID 2764398
6-bromo-1,3-benzodioxole-5-carbonitrile (PubChem CID 2764398) has the molecular formula C8H4BrNO2 and a molecular weight of 226.03 g/mol. Its IUPAC name is 6-bromo-1,3-benzodioxole-5-carbonitrile.
| Compound Name | 6-bromo-1,3-benzodioxole-5-carbonitrile |
|---|---|
| PubChem CID | 2764398 |
| Molecular Formula | C8H4BrNO2 |
| Molecular Weight | 226.03 g/mol |
| Exact Mass | 224.94 |
| IUPAC Name | 6-bromo-1,3-benzodioxole-5-carbonitrile |
| SMILES | N#Cc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C8H4BrNO2/c9-6-2-8-7(11-4-12-8)1-5(6)3-10/h1-2H,4H2 |
| InChIKey | YJAZLOORQHTWFN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.03 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |