About 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane
4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane (PubChem CID 159531778) has the molecular formula C9H6BrFN2
and a molecular weight of 241.06 g/mol. Its IUPAC name is 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane.
Molecular Properties
| Compound Name | 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane |
| PubChem CID | 159531778 |
| Molecular Formula | C9H6BrFN2 |
| Molecular Weight | 241.06 g/mol |
| Exact Mass | 239.97 |
| IUPAC Name | 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane |
| SMILES | C.N#Cc1cc(C#N)c(Br)cc1F |
| InChI | InChI=1S/C8H2BrFN2.CH4/c9-7-2-8(10)6(4-12)1-5(7)3-11;/h1-2H;1H4 |
| InChIKey | MDBXOOTYPTYSKZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.06 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane?
The IUPAC name of 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane (CID 159531778) is 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane.
What is the SMILES notation for 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane?
The canonical SMILES for 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane is C.N#Cc1cc(C#N)c(Br)cc1F.
What is the InChIKey of 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane?
The InChIKey is MDBXOOTYPTYSKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H2BrFN2.CH4/c9-7-2-8(10)6(4-12)1-5(7)3-11;/h1-2H;1H4.
What are the key properties of 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane?
4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane has a molecular weight of 241.06 g/mol, XLogP of 2.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-6-fluorobenzene-1,3-dicarbonitrile;methane is sourced from PubChem (CID 159531778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).