C7H2Br3N — CID 119003034
2,4,5-tribromobenzonitrile (PubChem CID 119003034) has the molecular formula C7H2Br3N and a molecular weight of 339.81 g/mol. Its IUPAC name is 2,4,5-tribromobenzonitrile.
| Compound Name | 2,4,5-tribromobenzonitrile |
|---|---|
| PubChem CID | 119003034 |
| Molecular Formula | C7H2Br3N |
| Molecular Weight | 339.81 g/mol |
| Exact Mass | 336.77 |
| IUPAC Name | 2,4,5-tribromobenzonitrile |
| SMILES | N#Cc1cc(Br)c(Br)cc1Br |
| InChI | InChI=1S/C7H2Br3N/c8-5-2-7(10)6(9)1-4(5)3-11/h1-2H |
| InChIKey | HYEIGZZZGGDMPJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.81 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|