C7H3Br2NO — CID 131338627
2,4-dibromo-5-hydroxybenzonitrile (PubChem CID 131338627) has the molecular formula C7H3Br2NO and a molecular weight of 276.92 g/mol. Its IUPAC name is 2,4-dibromo-5-hydroxybenzonitrile.
| Compound Name | 2,4-dibromo-5-hydroxybenzonitrile |
|---|---|
| PubChem CID | 131338627 |
| Molecular Formula | C7H3Br2NO |
| Molecular Weight | 276.92 g/mol |
| Exact Mass | 274.86 |
| IUPAC Name | 2,4-dibromo-5-hydroxybenzonitrile |
| SMILES | N#Cc1cc(O)c(Br)cc1Br |
| InChI | InChI=1S/C7H3Br2NO/c8-5-2-6(9)7(11)1-4(5)3-10/h1-2,11H |
| InChIKey | JJOFNCRTSRKBOG-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |