C10H4BrF2N — CID 163394126
6-bromo-3,3-difluoroindene-5-carbonitrile (PubChem CID 163394126) has the molecular formula C10H4BrF2N and a molecular weight of 256.05 g/mol. Its IUPAC name is 6-bromo-3,3-difluoroindene-5-carbonitrile.
| Compound Name | 6-bromo-3,3-difluoroindene-5-carbonitrile |
|---|---|
| PubChem CID | 163394126 |
| Molecular Formula | C10H4BrF2N |
| Molecular Weight | 256.05 g/mol |
| Exact Mass | 254.95 |
| IUPAC Name | 6-bromo-3,3-difluoroindene-5-carbonitrile |
| SMILES | N#Cc1cc2c(cc1Br)C=CC2(F)F |
| InChI | InChI=1S/C10H4BrF2N/c11-9-4-6-1-2-10(12,13)8(6)3-7(9)5-14/h1-4H |
| InChIKey | HAUVPVNCUQWRHR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.05 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |