About copper;2,4-dibromobenzonitrile;dicyanide
copper;2,4-dibromobenzonitrile;dicyanide (PubChem CID 162195305) has the molecular formula C9H3Br2CuN3
and a molecular weight of 376.50 g/mol. Its IUPAC name is copper;2,4-dibromobenzonitrile;dicyanide.
Molecular Properties
| Compound Name | copper;2,4-dibromobenzonitrile;dicyanide |
| PubChem CID | 162195305 |
| Molecular Formula | C9H3Br2CuN3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 373.80 |
| IUPAC Name | copper;2,4-dibromobenzonitrile;dicyanide |
| SMILES | N#Cc1ccc(Br)cc1Br.[C-]#N.[C-]#N.[Cu+2] |
| InChI | InChI=1S/C7H3Br2N.2CN.Cu/c8-6-2-1-5(4-10)7(9)3-6;2*1-2;/h1-3H;;;/q;2*-1;+2 |
| InChIKey | NEGIBQVDPHKFIJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper;2,4-dibromobenzonitrile;dicyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;2,4-dibromobenzonitrile;dicyanide?
The IUPAC name of copper;2,4-dibromobenzonitrile;dicyanide (CID 162195305) is copper;2,4-dibromobenzonitrile;dicyanide.
What is the SMILES notation for copper;2,4-dibromobenzonitrile;dicyanide?
The canonical SMILES for copper;2,4-dibromobenzonitrile;dicyanide is N#Cc1ccc(Br)cc1Br.[C-]#N.[C-]#N.[Cu+2].
What is the InChIKey of copper;2,4-dibromobenzonitrile;dicyanide?
The InChIKey is NEGIBQVDPHKFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2N.2CN.Cu/c8-6-2-1-5(4-10)7(9)3-6;2*1-2;/h1-3H;;;/q;2*-1;+2.
What are the key properties of copper;2,4-dibromobenzonitrile;dicyanide?
copper;2,4-dibromobenzonitrile;dicyanide has a molecular weight of 376.50 g/mol, XLogP of 3.27, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;2,4-dibromobenzonitrile;dicyanide is sourced from PubChem (CID 162195305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).