C7H6ClN3 — CID 171016548
2,5-diamino-4-chlorobenzonitrile (PubChem CID 171016548) has the molecular formula C7H6ClN3 and a molecular weight of 167.60 g/mol. Its IUPAC name is 2,5-diamino-4-chlorobenzonitrile.
| Compound Name | 2,5-diamino-4-chlorobenzonitrile |
|---|---|
| PubChem CID | 171016548 |
| Molecular Formula | C7H6ClN3 |
| Molecular Weight | 167.60 g/mol |
| Exact Mass | 167.03 |
| IUPAC Name | 2,5-diamino-4-chlorobenzonitrile |
| SMILES | N#Cc1cc(N)c(Cl)cc1N |
| InChI | InChI=1S/C7H6ClN3/c8-5-2-6(10)4(3-9)1-7(5)11/h1-2H,10-11H2 |
| InChIKey | ASFJFNLEKSKLOI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.60 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|