C8H9N3O — CID 171011985
2,4-diamino-5-methoxybenzonitrile (PubChem CID 171011985) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 2,4-diamino-5-methoxybenzonitrile.
| Compound Name | 2,4-diamino-5-methoxybenzonitrile |
|---|---|
| PubChem CID | 171011985 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 2,4-diamino-5-methoxybenzonitrile |
| SMILES | COc1cc(C#N)c(N)cc1N |
| InChI | InChI=1S/C8H9N3O/c1-12-8-2-5(4-9)6(10)3-7(8)11/h2-3H,10-11H2,1H3 |
| InChIKey | CNKLDOGPUWIPPQ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|