C12H15NS — CID 130914459
2,6-diethyl-1-benzothiophen-5-amine (PubChem CID 130914459) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 2,6-diethyl-1-benzothiophen-5-amine.
| Compound Name | 2,6-diethyl-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 130914459 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2,6-diethyl-1-benzothiophen-5-amine |
| SMILES | CCc1cc2cc(N)c(CC)cc2s1 |
| InChI | InChI=1S/C12H15NS/c1-3-8-7-12-9(6-11(8)13)5-10(4-2)14-12/h5-7H,3-4,13H2,1-2H3 |
| InChIKey | WHSOHYDKMCLYOS-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|