About 2-methyl-7H-thieno[3,2-f]indole
2-methyl-7H-thieno[3,2-f]indole (PubChem CID 69039188) has the molecular formula C11H9NS
and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-methyl-7H-thieno[3,2-f]indole.
Molecular Properties
| Compound Name | 2-methyl-7H-thieno[3,2-f]indole |
| PubChem CID | 69039188 |
| Molecular Formula | C11H9NS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-methyl-7H-thieno[3,2-f]indole |
| SMILES | Cc1cc2cc3cc[nH]c3cc2s1 |
| InChI | InChI=1S/C11H9NS/c1-7-4-9-5-8-2-3-12-10(8)6-11(9)13-7/h2-6,12H,1H3 |
| InChIKey | REAQAQWOFWLWCO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-7H-thieno[3,2-f]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7H-thieno[3,2-f]indole?
The IUPAC name of 2-methyl-7H-thieno[3,2-f]indole (CID 69039188) is 2-methyl-7H-thieno[3,2-f]indole.
What is the SMILES notation for 2-methyl-7H-thieno[3,2-f]indole?
The canonical SMILES for 2-methyl-7H-thieno[3,2-f]indole is Cc1cc2cc3cc[nH]c3cc2s1.
What is the InChIKey of 2-methyl-7H-thieno[3,2-f]indole?
The InChIKey is REAQAQWOFWLWCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS/c1-7-4-9-5-8-2-3-12-10(8)6-11(9)13-7/h2-6,12H,1H3.
What are the key properties of 2-methyl-7H-thieno[3,2-f]indole?
2-methyl-7H-thieno[3,2-f]indole has a molecular weight of 187.27 g/mol, XLogP of 3.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7H-thieno[3,2-f]indole is sourced from PubChem (CID 69039188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).