About hydron;6-methyl-1H-indole
hydron;6-methyl-1H-indole (PubChem CID 174894355) has the molecular formula C9H10N+
and a molecular weight of 132.19 g/mol. Its IUPAC name is hydron;6-methyl-1H-indole.
Molecular Properties
| Compound Name | hydron;6-methyl-1H-indole |
| PubChem CID | 174894355 |
| Molecular Formula | C9H10N+ |
| Molecular Weight | 132.19 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | hydron;6-methyl-1H-indole |
| SMILES | Cc1ccc2cc[nH]c2c1.[H+] |
| InChI | InChI=1S/C9H9N/c1-7-2-3-8-4-5-10-9(8)6-7/h2-6,10H,1H3/p+1 |
| InChIKey | ONYNOPPOVKYGRS-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze hydron;6-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;6-methyl-1H-indole?
The IUPAC name of hydron;6-methyl-1H-indole (CID 174894355) is hydron;6-methyl-1H-indole.
What is the SMILES notation for hydron;6-methyl-1H-indole?
The canonical SMILES for hydron;6-methyl-1H-indole is Cc1ccc2cc[nH]c2c1.[H+].
What is the InChIKey of hydron;6-methyl-1H-indole?
The InChIKey is ONYNOPPOVKYGRS-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H9N/c1-7-2-3-8-4-5-10-9(8)6-7/h2-6,10H,1H3/p+1.
What are the key properties of hydron;6-methyl-1H-indole?
hydron;6-methyl-1H-indole has a molecular weight of 132.19 g/mol, XLogP of 2.59, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;6-methyl-1H-indole is sourced from PubChem (CID 174894355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).