C18H18N2 — CID 146580457
6-[(6-methyl-2,3-dihydroindol-1-yl)methyl]-1H-indole (PubChem CID 146580457) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 6-[(6-methyl-2,3-dihydroindol-1-yl)methyl]-1H-indole.
| Compound Name | 6-[(6-methyl-2,3-dihydroindol-1-yl)methyl]-1H-indole |
|---|---|
| PubChem CID | 146580457 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 6-[(6-methyl-2,3-dihydroindol-1-yl)methyl]-1H-indole |
| SMILES | Cc1ccc2c(c1)N(Cc1ccc3cc[nH]c3c1)CC2 |
| InChI | InChI=1S/C18H18N2/c1-13-2-4-16-7-9-20(18(16)10-13)12-14-3-5-15-6-8-19-17(15)11-14/h2-6,8,10-11,19H,7,9,12H2,1H3 |
| InChIKey | QZMNOZFDTVUWDT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |