About 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine
3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine (PubChem CID 165142452) has the molecular formula C14H16N4
and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine |
| PubChem CID | 165142452 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine |
| SMILES | Cc1ccc2c(c1)N(Cc1nccnc1N)CC2 |
| InChI | InChI=1S/C14H16N4/c1-10-2-3-11-4-7-18(13(11)8-10)9-12-14(15)17-6-5-16-12/h2-3,5-6,8H,4,7,9H2,1H3,(H2,15,17) |
| InChIKey | VGVSQPBOYUSURG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine?
The IUPAC name of 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine (CID 165142452) is 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine.
What is the SMILES notation for 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine?
The canonical SMILES for 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine is Cc1ccc2c(c1)N(Cc1nccnc1N)CC2.
What is the InChIKey of 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine?
The InChIKey is VGVSQPBOYUSURG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4/c1-10-2-3-11-4-7-18(13(11)8-10)9-12-14(15)17-6-5-16-12/h2-3,5-6,8H,4,7,9H2,1H3,(H2,15,17).
What are the key properties of 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine?
3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine has a molecular weight of 240.31 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-methyl-2,3-dihydroindol-1-yl)methyl]pyrazin-2-amine is sourced from PubChem (CID 165142452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).