About 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline
7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline (PubChem CID 166359693) has the molecular formula C19H18N2
and a molecular weight of 274.37 g/mol. Its IUPAC name is 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline.
Molecular Properties
| Compound Name | 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline |
| PubChem CID | 166359693 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline |
| SMILES | Cc1ccc2c(c1)N(Cc1ccc3ccncc3c1)CC2 |
| InChI | InChI=1S/C19H18N2/c1-14-2-4-17-7-9-21(19(17)10-14)13-15-3-5-16-6-8-20-12-18(16)11-15/h2-6,8,10-12H,7,9,13H2,1H3 |
| InChIKey | VXQVULQIDMACFG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline?
The IUPAC name of 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline (CID 166359693) is 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline.
What is the SMILES notation for 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline?
The canonical SMILES for 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline is Cc1ccc2c(c1)N(Cc1ccc3ccncc3c1)CC2.
What is the InChIKey of 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline?
The InChIKey is VXQVULQIDMACFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2/c1-14-2-4-17-7-9-21(19(17)10-14)13-15-3-5-16-6-8-20-12-18(16)11-15/h2-6,8,10-12H,7,9,13H2,1H3.
What are the key properties of 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline?
7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline has a molecular weight of 274.37 g/mol, XLogP of 4.11, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(6-methyl-2,3-dihydroindol-1-yl)methyl]isoquinoline is sourced from PubChem (CID 166359693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).