C18H23NSi — CID 103438257
[4-(2,3-dihydroindol-1-ylmethyl)phenyl]-trimethylsilane (PubChem CID 103438257) has the molecular formula C18H23NSi and a molecular weight of 281.48 g/mol. Its IUPAC name is [4-(2,3-dihydroindol-1-ylmethyl)phenyl]-trimethylsilane.
| Compound Name | [4-(2,3-dihydroindol-1-ylmethyl)phenyl]-trimethylsilane |
|---|---|
| PubChem CID | 103438257 |
| Molecular Formula | C18H23NSi |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [4-(2,3-dihydroindol-1-ylmethyl)phenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1ccc(CN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H23NSi/c1-20(2,3)17-10-8-15(9-11-17)14-19-13-12-16-6-4-5-7-18(16)19/h4-11H,12-14H2,1-3H3 |
| InChIKey | FFIHLKPNFUEJBD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|