C21H26BNO2 — CID 154074412
1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,3-dihydroindole (PubChem CID 154074412) has the molecular formula C21H26BNO2 and a molecular weight of 335.26 g/mol. Its IUPAC name is 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,3-dihydroindole.
| Compound Name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 154074412 |
| Molecular Formula | C21H26BNO2 |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 1-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]-2,3-dihydroindole |
| SMILES | CC1(C)OB(c2ccc(CN3CCc4ccccc43)cc2)OC1(C)C |
| InChI | InChI=1S/C21H26BNO2/c1-20(2)21(3,4)25-22(24-20)18-11-9-16(10-12-18)15-23-14-13-17-7-5-6-8-19(17)23/h5-12H,13-15H2,1-4H3 |
| InChIKey | BVQXBVNKWYPQOM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|