C16H18N2 — CID 16793024
[4-(2,3-dihydroindol-1-ylmethyl)phenyl]methanamine (PubChem CID 16793024) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [4-(2,3-dihydroindol-1-ylmethyl)phenyl]methanamine.
| Compound Name | [4-(2,3-dihydroindol-1-ylmethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 16793024 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | [4-(2,3-dihydroindol-1-ylmethyl)phenyl]methanamine |
| SMILES | NCc1ccc(CN2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C16H18N2/c17-11-13-5-7-14(8-6-13)12-18-10-9-15-3-1-2-4-16(15)18/h1-8H,9-12,17H2 |
| InChIKey | OEZFNZZRJOEHHS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |