C22H28BNO3 — CID 113249418
1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]-2,3-dihydroindole (PubChem CID 113249418) has the molecular formula C22H28BNO3 and a molecular weight of 365.28 g/mol. Its IUPAC name is 1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]-2,3-dihydroindole.
| Compound Name | 1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 113249418 |
| Molecular Formula | C22H28BNO3 |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | 1-[2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl]-2,3-dihydroindole |
| SMILES | CC1(C)OB(c2cccc(OCCN3CCc4ccccc43)c2)OC1(C)C |
| InChI | InChI=1S/C22H28BNO3/c1-21(2)22(3,4)27-23(26-21)18-9-7-10-19(16-18)25-15-14-24-13-12-17-8-5-6-11-20(17)24/h5-11,16H,12-15H2,1-4H3 |
| InChIKey | LLTZWNIHRFVNIC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|