C21H33BO5 — CID 58151419
4,4,5,5-tetramethyl-2-[3-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl]-1,3,2-dioxaborolane (PubChem CID 58151419) has the molecular formula C21H33BO5 and a molecular weight of 376.30 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[3-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[3-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 58151419 |
| Molecular Formula | C21H33BO5 |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[3-[4-[(3-methyloxetan-3-yl)methoxy]butoxy]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(COCCCCOc2cccc(B3OC(C)(C)C(C)(C)O3)c2)COC1 |
| InChI | InChI=1S/C21H33BO5/c1-19(2)20(3,4)27-22(26-19)17-9-8-10-18(13-17)25-12-7-6-11-23-14-21(5)15-24-16-21/h8-10,13H,6-7,11-12,14-16H2,1-5H3 |
| InChIKey | MJIJKLZPNBKPGU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|