C13H13NO — CID 14884168
1-(furan-2-ylmethyl)-2,3-dihydroindole (PubChem CID 14884168) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2,3-dihydroindole.
| Compound Name | 1-(furan-2-ylmethyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 14884168 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2,3-dihydroindole |
| SMILES | c1coc(CN2CCc3ccccc32)c1 |
| InChI | InChI=1S/C13H13NO/c1-2-6-13-11(4-1)7-8-14(13)10-12-5-3-9-15-12/h1-6,9H,7-8,10H2 |
| InChIKey | DMAFKUJRVDYSNW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |